C13H14Cl2FN3 — CID 63530614
5-(2,4-dichloro-5-fluorophenyl)-N-(2-methylpropyl)-1H-pyrazol-3-amine (PubChem CID 63530614) has the molecular formula C13H14Cl2FN3 and a molecular weight of 302.18 g/mol. Its IUPAC name is 5-(2,4-dichloro-5-fluorophenyl)-N-(2-methylpropyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(2,4-dichloro-5-fluorophenyl)-N-(2-methylpropyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 63530614 |
| Molecular Formula | C13H14Cl2FN3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 5-(2,4-dichloro-5-fluorophenyl)-N-(2-methylpropyl)-1H-pyrazol-3-amine |
| SMILES | CC(C)CNc1cc(-c2cc(F)c(Cl)cc2Cl)[nH]n1 |
| InChI | InChI=1S/C13H14Cl2FN3/c1-7(2)6-17-13-5-12(18-19-13)8-3-11(16)10(15)4-9(8)14/h3-5,7H,6H2,1-2H3,(H2,17,18,19) |
| InChIKey | KILXJXWHTMJFLM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|