C18H33NO2 — CID 63541396
(3,3,5-trimethylcyclohexyl) 3-propylpiperidine-3-carboxylate (PubChem CID 63541396) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) 3-propylpiperidine-3-carboxylate.
| Compound Name | (3,3,5-trimethylcyclohexyl) 3-propylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 63541396 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) 3-propylpiperidine-3-carboxylate |
| SMILES | CCCC1(C(=O)OC2CC(C)CC(C)(C)C2)CCCNC1 |
| InChI | InChI=1S/C18H33NO2/c1-5-7-18(8-6-9-19-13-18)16(20)21-15-10-14(2)11-17(3,4)12-15/h14-15,19H,5-13H2,1-4H3 |
| InChIKey | NCSGWFWNPZWPBD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |