C14H29N3O — CID 63558335
3-[4-(oxolan-3-yl)-1,4-diazepan-1-yl]pentan-1-amine (PubChem CID 63558335) has the molecular formula C14H29N3O and a molecular weight of 255.41 g/mol. Its IUPAC name is 3-[4-(oxolan-3-yl)-1,4-diazepan-1-yl]pentan-1-amine.
| Compound Name | 3-[4-(oxolan-3-yl)-1,4-diazepan-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 63558335 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | 3-[4-(oxolan-3-yl)-1,4-diazepan-1-yl]pentan-1-amine |
| SMILES | CCC(CCN)N1CCCN(C2CCOC2)CC1 |
| InChI | InChI=1S/C14H29N3O/c1-2-13(4-6-15)16-7-3-8-17(10-9-16)14-5-11-18-12-14/h13-14H,2-12,15H2,1H3 |
| InChIKey | LWFFILGFFQITCW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |