C12H12N4O2 — CID 63562926
3-(1H-benzimidazol-2-ylamino)-1-methylpyrrolidine-2,5-dione (PubChem CID 63562926) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-ylamino)-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-(1H-benzimidazol-2-ylamino)-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 63562926 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-(1H-benzimidazol-2-ylamino)-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(Nc2nc3ccccc3[nH]2)C1=O |
| InChI | InChI=1S/C12H12N4O2/c1-16-10(17)6-9(11(16)18)15-12-13-7-4-2-3-5-8(7)14-12/h2-5,9H,6H2,1H3,(H2,13,14,15) |
| InChIKey | SEQZPCVDQQMJNM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|