C11H17NO3 — CID 63563829
2-[[2-(cyclohexen-1-yl)acetyl]-methylamino]acetic acid (PubChem CID 63563829) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[[2-(cyclohexen-1-yl)acetyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-(cyclohexen-1-yl)acetyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 63563829 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-[[2-(cyclohexen-1-yl)acetyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)CC1=CCCCC1 |
| InChI | InChI=1S/C11H17NO3/c1-12(8-11(14)15)10(13)7-9-5-3-2-4-6-9/h5H,2-4,6-8H2,1H3,(H,14,15) |
| InChIKey | URPUIUYNMWEJKB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|