C16H18ClNO3 — CID 63565168
2-(3-chloro-N-[2-(cyclohexen-1-yl)acetyl]anilino)acetic acid (PubChem CID 63565168) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 2-(3-chloro-N-[2-(cyclohexen-1-yl)acetyl]anilino)acetic acid.
| Compound Name | 2-(3-chloro-N-[2-(cyclohexen-1-yl)acetyl]anilino)acetic acid |
|---|---|
| PubChem CID | 63565168 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-(3-chloro-N-[2-(cyclohexen-1-yl)acetyl]anilino)acetic acid |
| SMILES | O=C(O)CN(C(=O)CC1=CCCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H18ClNO3/c17-13-7-4-8-14(10-13)18(11-16(20)21)15(19)9-12-5-2-1-3-6-12/h4-5,7-8,10H,1-3,6,9,11H2,(H,20,21) |
| InChIKey | QSBPJASRUDUCEF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|