C12H15BrN4O2 — CID 63577257
5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-methylfuran-2-carbohydrazide (PubChem CID 63577257) has the molecular formula C12H15BrN4O2 and a molecular weight of 327.18 g/mol. Its IUPAC name is 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-methylfuran-2-carbohydrazide.
| Compound Name | 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-methylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 63577257 |
| Molecular Formula | C12H15BrN4O2 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-methylfuran-2-carbohydrazide |
| SMILES | Cc1cc(Cn2nc(C)c(Br)c2C)oc1C(=O)NN |
| InChI | InChI=1S/C12H15BrN4O2/c1-6-4-9(19-11(6)12(18)15-14)5-17-8(3)10(13)7(2)16-17/h4H,5,14H2,1-3H3,(H,15,18) |
| InChIKey | FNAIWFPPRYZERF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|