C12H13N3O3 — CID 63578343
3-methyl-5-[(4-oxo-1-pyridinyl)methyl]furan-2-carbohydrazide (PubChem CID 63578343) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 3-methyl-5-[(4-oxo-1-pyridinyl)methyl]furan-2-carbohydrazide.
| Compound Name | 3-methyl-5-[(4-oxo-1-pyridinyl)methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 63578343 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-methyl-5-[(4-oxo-1-pyridinyl)methyl]furan-2-carbohydrazide |
| SMILES | Cc1cc(Cn2ccc(=O)cc2)oc1C(=O)NN |
| InChI | InChI=1S/C12H13N3O3/c1-8-6-10(18-11(8)12(17)14-13)7-15-4-2-9(16)3-5-15/h2-6H,7,13H2,1H3,(H,14,17) |
| InChIKey | FABUKLLFRKETCY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|