C12H11NO4 — CID 62880491
2-methyl-5-[(4-oxo-1-pyridinyl)methyl]furan-3-carboxylic acid (PubChem CID 62880491) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 2-methyl-5-[(4-oxo-1-pyridinyl)methyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[(4-oxo-1-pyridinyl)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 62880491 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2-methyl-5-[(4-oxo-1-pyridinyl)methyl]furan-3-carboxylic acid |
| SMILES | Cc1oc(Cn2ccc(=O)cc2)cc1C(=O)O |
| InChI | InChI=1S/C12H11NO4/c1-8-11(12(15)16)6-10(17-8)7-13-4-2-9(14)3-5-13/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | PZJRWTATDVNCMJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |