C13H14N6 — CID 63586757
N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]cinnolin-4-amine (PubChem CID 63586757) has the molecular formula C13H14N6 and a molecular weight of 254.30 g/mol. Its IUPAC name is N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]cinnolin-4-amine.
| Compound Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]cinnolin-4-amine |
|---|---|
| PubChem CID | 63586757 |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]cinnolin-4-amine |
| SMILES | Cn1cnnc1CCNc1cnnc2ccccc12 |
| InChI | InChI=1S/C13H14N6/c1-19-9-16-18-13(19)6-7-14-12-8-15-17-11-5-3-2-4-10(11)12/h2-5,8-9H,6-7H2,1H3,(H,14,17) |
| InChIKey | DWGJPECZFUFEMF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |