C11H15N3O — CID 63590190
N-amino-N'-methyl-3,4-dihydro-2H-chromene-3-carboximidamide (PubChem CID 63590190) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is N-amino-N'-methyl-3,4-dihydro-2H-chromene-3-carboximidamide.
| Compound Name | N-amino-N'-methyl-3,4-dihydro-2H-chromene-3-carboximidamide |
|---|---|
| PubChem CID | 63590190 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-amino-N'-methyl-3,4-dihydro-2H-chromene-3-carboximidamide |
| SMILES | C/N=C(\NN)C1COc2ccccc2C1 |
| InChI | InChI=1S/C11H15N3O/c1-13-11(14-12)9-6-8-4-2-3-5-10(8)15-7-9/h2-5,9H,6-7,12H2,1H3,(H,13,14) |
| InChIKey | KAIPIGSBJOSHLV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|