C10H6F3N5O — CID 63593181
1-[2-amino-5-(difluoromethoxy)-4-fluorophenyl]-1,2,4-triazole-3-carbonitrile (PubChem CID 63593181) has the molecular formula C10H6F3N5O and a molecular weight of 269.19 g/mol. Its IUPAC name is 1-[2-amino-5-(difluoromethoxy)-4-fluorophenyl]-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-[2-amino-5-(difluoromethoxy)-4-fluorophenyl]-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 63593181 |
| Molecular Formula | C10H6F3N5O |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 1-[2-amino-5-(difluoromethoxy)-4-fluorophenyl]-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1ncn(-c2cc(OC(F)F)c(F)cc2N)n1 |
| InChI | InChI=1S/C10H6F3N5O/c11-5-1-6(15)7(2-8(5)19-10(12)13)18-4-16-9(3-14)17-18/h1-2,4,10H,15H2 |
| InChIKey | MICRVICVXPZCRI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|