C10H8FN5 — CID 103590875
1-(2-amino-4-fluoro-5-methylphenyl)-1,2,4-triazole-3-carbonitrile (PubChem CID 103590875) has the molecular formula C10H8FN5 and a molecular weight of 217.21 g/mol. Its IUPAC name is 1-(2-amino-4-fluoro-5-methylphenyl)-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-(2-amino-4-fluoro-5-methylphenyl)-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 103590875 |
| Molecular Formula | C10H8FN5 |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 1-(2-amino-4-fluoro-5-methylphenyl)-1,2,4-triazole-3-carbonitrile |
| SMILES | Cc1cc(-n2cnc(C#N)n2)c(N)cc1F |
| InChI | InChI=1S/C10H8FN5/c1-6-2-9(8(13)3-7(6)11)16-5-14-10(4-12)15-16/h2-3,5H,13H2,1H3 |
| InChIKey | ZLKFFXALQZIWDI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|