C14H16FN3 — CID 103590887
5-fluoro-4-methyl-2-(4,5,6,7-tetrahydrobenzimidazol-1-yl)aniline (PubChem CID 103590887) has the molecular formula C14H16FN3 and a molecular weight of 245.30 g/mol. Its IUPAC name is 5-fluoro-4-methyl-2-(4,5,6,7-tetrahydrobenzimidazol-1-yl)aniline.
| Compound Name | 5-fluoro-4-methyl-2-(4,5,6,7-tetrahydrobenzimidazol-1-yl)aniline |
|---|---|
| PubChem CID | 103590887 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 5-fluoro-4-methyl-2-(4,5,6,7-tetrahydrobenzimidazol-1-yl)aniline |
| SMILES | Cc1cc(-n2cnc3c2CCCC3)c(N)cc1F |
| InChI | InChI=1S/C14H16FN3/c1-9-6-14(11(16)7-10(9)15)18-8-17-12-4-2-3-5-13(12)18/h6-8H,2-5,16H2,1H3 |
| InChIKey | XBZUWDSEFMVEQC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|