C17H18N2O2 — CID 105407649
(E)-3-[4-methyl-3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)phenyl]prop-2-enoic acid (PubChem CID 105407649) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (E)-3-[4-methyl-3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-methyl-3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 105407649 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (E)-3-[4-methyl-3-(4,5,6,7-tetrahydrobenzimidazol-1-yl)phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(/C=C/C(=O)O)cc1-n1cnc2c1CCCC2 |
| InChI | InChI=1S/C17H18N2O2/c1-12-6-7-13(8-9-17(20)21)10-16(12)19-11-18-14-4-2-3-5-15(14)19/h6-11H,2-5H2,1H3,(H,20,21)/b9-8+ |
| InChIKey | LZEJZNRQFCCTBD-CMDGGOBGSA-N |
| XLogP | 3.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|