C13H15Cl2N3O2 — CID 63595395
4-(3-amino-4,5-dichlorobenzoyl)-3,3-dimethylpiperazin-2-one (PubChem CID 63595395) has the molecular formula C13H15Cl2N3O2 and a molecular weight of 316.19 g/mol. Its IUPAC name is 4-(3-amino-4,5-dichlorobenzoyl)-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-(3-amino-4,5-dichlorobenzoyl)-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 63595395 |
| Molecular Formula | C13H15Cl2N3O2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 4-(3-amino-4,5-dichlorobenzoyl)-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1C(=O)c1cc(N)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2N3O2/c1-13(2)12(20)17-3-4-18(13)11(19)7-5-8(14)10(15)9(16)6-7/h5-6H,3-4,16H2,1-2H3,(H,17,20) |
| InChIKey | IOPPVNDEFLDFLI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|