C12H23N3O2 — CID 63601251
N-butyl-2-(3,3-dimethyl-2-oxopiperazin-1-yl)acetamide (PubChem CID 63601251) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is N-butyl-2-(3,3-dimethyl-2-oxopiperazin-1-yl)acetamide.
| Compound Name | N-butyl-2-(3,3-dimethyl-2-oxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 63601251 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-butyl-2-(3,3-dimethyl-2-oxopiperazin-1-yl)acetamide |
| SMILES | CCCCNC(=O)CN1CCNC(C)(C)C1=O |
| InChI | InChI=1S/C12H23N3O2/c1-4-5-6-13-10(16)9-15-8-7-14-12(2,3)11(15)17/h14H,4-9H2,1-3H3,(H,13,16) |
| InChIKey | NYKQSFVNNPFUSP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|