C12H11Cl2N3O4 — CID 63608083
4-(3,4-dichloro-5-nitrobenzoyl)-3-methylpiperazin-2-one (PubChem CID 63608083) has the molecular formula C12H11Cl2N3O4 and a molecular weight of 332.14 g/mol. Its IUPAC name is 4-(3,4-dichloro-5-nitrobenzoyl)-3-methylpiperazin-2-one.
| Compound Name | 4-(3,4-dichloro-5-nitrobenzoyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 63608083 |
| Molecular Formula | C12H11Cl2N3O4 |
| Molecular Weight | 332.14 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 4-(3,4-dichloro-5-nitrobenzoyl)-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1C(=O)c1cc(Cl)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H11Cl2N3O4/c1-6-11(18)15-2-3-16(6)12(19)7-4-8(13)10(14)9(5-7)17(20)21/h4-6H,2-3H2,1H3,(H,15,18) |
| InChIKey | XLEMHSKSIAOCLZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.14 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|