C14H13Cl2FN2 — CID 63611318
4,6-dichloro-2-[(4-fluorophenyl)methyl]-5-propylpyrimidine (PubChem CID 63611318) has the molecular formula C14H13Cl2FN2 and a molecular weight of 299.18 g/mol. Its IUPAC name is 4,6-dichloro-2-[(4-fluorophenyl)methyl]-5-propylpyrimidine.
| Compound Name | 4,6-dichloro-2-[(4-fluorophenyl)methyl]-5-propylpyrimidine |
|---|---|
| PubChem CID | 63611318 |
| Molecular Formula | C14H13Cl2FN2 |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4,6-dichloro-2-[(4-fluorophenyl)methyl]-5-propylpyrimidine |
| SMILES | CCCc1c(Cl)nc(Cc2ccc(F)cc2)nc1Cl |
| InChI | InChI=1S/C14H13Cl2FN2/c1-2-3-11-13(15)18-12(19-14(11)16)8-9-4-6-10(17)7-5-9/h4-7H,2-3,8H2,1H3 |
| InChIKey | PQOIMKKWGRUIEX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |