C14H15N3S2 — CID 63616126
N,6-diethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 63616126) has the molecular formula C14H15N3S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is N,6-diethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N,6-diethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63616126 |
| Molecular Formula | C14H15N3S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N,6-diethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCNc1nc(-c2ccsc2)nc2sc(CC)cc12 |
| InChI | InChI=1S/C14H15N3S2/c1-3-10-7-11-13(15-4-2)16-12(17-14(11)19-10)9-5-6-18-8-9/h5-8H,3-4H2,1-2H3,(H,15,16,17) |
| InChIKey | TTYDZKNLZFFIRU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |