C12H15BrO — CID 63631152
6-bromo-2-ethyl-3,4-dihydro-1H-naphthalen-2-ol (PubChem CID 63631152) has the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. Its IUPAC name is 6-bromo-2-ethyl-3,4-dihydro-1H-naphthalen-2-ol.
| Compound Name | 6-bromo-2-ethyl-3,4-dihydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 63631152 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 6-bromo-2-ethyl-3,4-dihydro-1H-naphthalen-2-ol |
| SMILES | CCC1(O)CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C12H15BrO/c1-2-12(14)6-5-9-7-11(13)4-3-10(9)8-12/h3-4,7,14H,2,5-6,8H2,1H3 |
| InChIKey | VADHOVXZEBPUOH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |