C14H13ClN4O — CID 63637402
2-[[4-chloro-6-(methoxymethyl)pyrimidin-2-yl]methyl]-1H-benzimidazole (PubChem CID 63637402) has the molecular formula C14H13ClN4O and a molecular weight of 288.74 g/mol. Its IUPAC name is 2-[[4-chloro-6-(methoxymethyl)pyrimidin-2-yl]methyl]-1H-benzimidazole.
| Compound Name | 2-[[4-chloro-6-(methoxymethyl)pyrimidin-2-yl]methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 63637402 |
| Molecular Formula | C14H13ClN4O |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-[[4-chloro-6-(methoxymethyl)pyrimidin-2-yl]methyl]-1H-benzimidazole |
| SMILES | COCc1cc(Cl)nc(Cc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C14H13ClN4O/c1-20-8-9-6-12(15)19-13(16-9)7-14-17-10-4-2-3-5-11(10)18-14/h2-6H,7-8H2,1H3,(H,17,18) |
| InChIKey | XYNCZNDYSKQZEX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |