C14H12ClIN4O — CID 66293043
2-[[4-chloro-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]methyl]-1H-benzimidazole (PubChem CID 66293043) has the molecular formula C14H12ClIN4O and a molecular weight of 414.63 g/mol. Its IUPAC name is 2-[[4-chloro-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]methyl]-1H-benzimidazole.
| Compound Name | 2-[[4-chloro-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 66293043 |
| Molecular Formula | C14H12ClIN4O |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | 2-[[4-chloro-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]methyl]-1H-benzimidazole |
| SMILES | COCc1nc(Cc2nc3ccccc3[nH]2)nc(Cl)c1I |
| InChI | InChI=1S/C14H12ClIN4O/c1-21-7-10-13(16)14(15)20-12(19-10)6-11-17-8-4-2-3-5-9(8)18-11/h2-5H,6-7H2,1H3,(H,17,18) |
| InChIKey | HFFBUXLWWSCGKB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|