C12H16O4S2 — CID 63639577
3-(cyclopentylmethylsulfonylmethyl)thiophene-2-carboxylic acid (PubChem CID 63639577) has the molecular formula C12H16O4S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-(cyclopentylmethylsulfonylmethyl)thiophene-2-carboxylic acid.
| Compound Name | 3-(cyclopentylmethylsulfonylmethyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63639577 |
| Molecular Formula | C12H16O4S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 3-(cyclopentylmethylsulfonylmethyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1CS(=O)(=O)CC1CCCC1 |
| InChI | InChI=1S/C12H16O4S2/c13-12(14)11-10(5-6-17-11)8-18(15,16)7-9-3-1-2-4-9/h5-6,9H,1-4,7-8H2,(H,13,14) |
| InChIKey | YHVDKZWQUIEGEO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |