C13H16O6S2 — CID 107776566
3-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfonylmethyl]thiophene-2-carboxylic acid (PubChem CID 107776566) has the molecular formula C13H16O6S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfonylmethyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfonylmethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 107776566 |
| Molecular Formula | C13H16O6S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 3-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfonylmethyl]thiophene-2-carboxylic acid |
| SMILES | COC(=O)CC1(CS(=O)(=O)Cc2ccsc2C(=O)O)CC1 |
| InChI | InChI=1S/C13H16O6S2/c1-19-10(14)6-13(3-4-13)8-21(17,18)7-9-2-5-20-11(9)12(15)16/h2,5H,3-4,6-8H2,1H3,(H,15,16) |
| InChIKey | PENDWLWGNJPLTM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |