C12H15BrO4S2 — CID 107776694
methyl 2-[1-[(5-bromothiophen-2-yl)methylsulfonylmethyl]cyclopropyl]acetate (PubChem CID 107776694) has the molecular formula C12H15BrO4S2 and a molecular weight of 367.29 g/mol. Its IUPAC name is methyl 2-[1-[(5-bromothiophen-2-yl)methylsulfonylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(5-bromothiophen-2-yl)methylsulfonylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776694 |
| Molecular Formula | C12H15BrO4S2 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | methyl 2-[1-[(5-bromothiophen-2-yl)methylsulfonylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)(=O)Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C12H15BrO4S2/c1-17-11(14)6-12(4-5-12)8-19(15,16)7-9-2-3-10(13)18-9/h2-3H,4-8H2,1H3 |
| InChIKey | XRBYEVBQHOCFTM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |