C11H20O6S2 — CID 107776601
methyl 2-[1-(2-ethylsulfonylethylsulfonylmethyl)cyclopropyl]acetate (PubChem CID 107776601) has the molecular formula C11H20O6S2 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl 2-[1-(2-ethylsulfonylethylsulfonylmethyl)cyclopropyl]acetate.
| Compound Name | methyl 2-[1-(2-ethylsulfonylethylsulfonylmethyl)cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776601 |
| Molecular Formula | C11H20O6S2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | methyl 2-[1-(2-ethylsulfonylethylsulfonylmethyl)cyclopropyl]acetate |
| SMILES | CCS(=O)(=O)CCS(=O)(=O)CC1(CC(=O)OC)CC1 |
| InChI | InChI=1S/C11H20O6S2/c1-3-18(13,14)6-7-19(15,16)9-11(4-5-11)8-10(12)17-2/h3-9H2,1-2H3 |
| InChIKey | PNCZBOUYSZFFTJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |