C14H26O6S — CID 107778650
methyl 2-[1-(3,3-diethoxypropylsulfonylmethyl)cyclopropyl]acetate (PubChem CID 107778650) has the molecular formula C14H26O6S and a molecular weight of 322.42 g/mol. Its IUPAC name is methyl 2-[1-(3,3-diethoxypropylsulfonylmethyl)cyclopropyl]acetate.
| Compound Name | methyl 2-[1-(3,3-diethoxypropylsulfonylmethyl)cyclopropyl]acetate |
|---|---|
| PubChem CID | 107778650 |
| Molecular Formula | C14H26O6S |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | methyl 2-[1-(3,3-diethoxypropylsulfonylmethyl)cyclopropyl]acetate |
| SMILES | CCOC(CCS(=O)(=O)CC1(CC(=O)OC)CC1)OCC |
| InChI | InChI=1S/C14H26O6S/c1-4-19-13(20-5-2)6-9-21(16,17)11-14(7-8-14)10-12(15)18-3/h13H,4-11H2,1-3H3 |
| InChIKey | ZFERJKGJPYQWSU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|