C12H22O6S — CID 103179865
2-[1-[2-(3-methoxypropoxy)ethylsulfonylmethyl]cyclopropyl]acetic acid (PubChem CID 103179865) has the molecular formula C12H22O6S and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-[1-[2-(3-methoxypropoxy)ethylsulfonylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[2-(3-methoxypropoxy)ethylsulfonylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 103179865 |
| Molecular Formula | C12H22O6S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-[1-[2-(3-methoxypropoxy)ethylsulfonylmethyl]cyclopropyl]acetic acid |
| SMILES | COCCCOCCS(=O)(=O)CC1(CC(=O)O)CC1 |
| InChI | InChI=1S/C12H22O6S/c1-17-5-2-6-18-7-8-19(15,16)10-12(3-4-12)9-11(13)14/h2-10H2,1H3,(H,13,14) |
| InChIKey | VLZYZZLUSGYUFO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|