C10H18O5S — CID 65443911
2-[1-(2-ethoxyethylsulfonylmethyl)cyclopropyl]acetic acid (PubChem CID 65443911) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[1-(2-ethoxyethylsulfonylmethyl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(2-ethoxyethylsulfonylmethyl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65443911 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-[1-(2-ethoxyethylsulfonylmethyl)cyclopropyl]acetic acid |
| SMILES | CCOCCS(=O)(=O)CC1(CC(=O)O)CC1 |
| InChI | InChI=1S/C10H18O5S/c1-2-15-5-6-16(13,14)8-10(3-4-10)7-9(11)12/h2-8H2,1H3,(H,11,12) |
| InChIKey | UMRRYISSPLLSEU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|