C12H23NO4S — CID 114000474
methyl 2-[1-[2-(propan-2-ylamino)ethylsulfonylmethyl]cyclopropyl]acetate (PubChem CID 114000474) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is methyl 2-[1-[2-(propan-2-ylamino)ethylsulfonylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[2-(propan-2-ylamino)ethylsulfonylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 114000474 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | methyl 2-[1-[2-(propan-2-ylamino)ethylsulfonylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)(=O)CCNC(C)C)CC1 |
| InChI | InChI=1S/C12H23NO4S/c1-10(2)13-6-7-18(15,16)9-12(4-5-12)8-11(14)17-3/h10,13H,4-9H2,1-3H3 |
| InChIKey | RALQGWLTKVWCGJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |