C12H21NO6S — CID 107776835
methyl 2-[1-[[2-(2-methoxyethylamino)-2-oxoethyl]sulfonylmethyl]cyclopropyl]acetate (PubChem CID 107776835) has the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. Its IUPAC name is methyl 2-[1-[[2-(2-methoxyethylamino)-2-oxoethyl]sulfonylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[[2-(2-methoxyethylamino)-2-oxoethyl]sulfonylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776835 |
| Molecular Formula | C12H21NO6S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | methyl 2-[1-[[2-(2-methoxyethylamino)-2-oxoethyl]sulfonylmethyl]cyclopropyl]acetate |
| SMILES | COCCNC(=O)CS(=O)(=O)CC1(CC(=O)OC)CC1 |
| InChI | InChI=1S/C12H21NO6S/c1-18-6-5-13-10(14)8-20(16,17)9-12(3-4-12)7-11(15)19-2/h3-9H2,1-2H3,(H,13,14) |
| InChIKey | VPLMSMLADHHLRU-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|