C11H21NO4S — CID 114000529
methyl 2-[1-(4-aminobutan-2-ylsulfonylmethyl)cyclopropyl]acetate (PubChem CID 114000529) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is methyl 2-[1-(4-aminobutan-2-ylsulfonylmethyl)cyclopropyl]acetate.
| Compound Name | methyl 2-[1-(4-aminobutan-2-ylsulfonylmethyl)cyclopropyl]acetate |
|---|---|
| PubChem CID | 114000529 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 2-[1-(4-aminobutan-2-ylsulfonylmethyl)cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)(=O)C(C)CCN)CC1 |
| InChI | InChI=1S/C11H21NO4S/c1-9(3-6-12)17(14,15)8-11(4-5-11)7-10(13)16-2/h9H,3-8,12H2,1-2H3 |
| InChIKey | QOILQTAKFDRDBT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |