C11H18O4S — CID 107776814
methyl 2-[1-(cyclobutylsulfonylmethyl)cyclopropyl]acetate (PubChem CID 107776814) has the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. Its IUPAC name is methyl 2-[1-(cyclobutylsulfonylmethyl)cyclopropyl]acetate.
| Compound Name | methyl 2-[1-(cyclobutylsulfonylmethyl)cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776814 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | methyl 2-[1-(cyclobutylsulfonylmethyl)cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C11H18O4S/c1-15-10(12)7-11(5-6-11)8-16(13,14)9-3-2-4-9/h9H,2-8H2,1H3 |
| InChIKey | QFUQBYAWFQTYBY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |