C15H27NO4S — CID 107778198
methyl 2-[1-[(2-amino-5-ethylcyclohexyl)sulfonylmethyl]cyclopropyl]acetate (PubChem CID 107778198) has the molecular formula C15H27NO4S and a molecular weight of 317.45 g/mol. Its IUPAC name is methyl 2-[1-[(2-amino-5-ethylcyclohexyl)sulfonylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(2-amino-5-ethylcyclohexyl)sulfonylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107778198 |
| Molecular Formula | C15H27NO4S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | methyl 2-[1-[(2-amino-5-ethylcyclohexyl)sulfonylmethyl]cyclopropyl]acetate |
| SMILES | CCC1CCC(N)C(S(=O)(=O)CC2(CC(=O)OC)CC2)C1 |
| InChI | InChI=1S/C15H27NO4S/c1-3-11-4-5-12(16)13(8-11)21(18,19)10-15(6-7-15)9-14(17)20-2/h11-13H,3-10,16H2,1-2H3 |
| InChIKey | UYKTUQQTAHLTDL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |