C14H17ClO4S — CID 107776727
methyl 2-[1-[(4-chlorophenyl)methylsulfonylmethyl]cyclopropyl]acetate (PubChem CID 107776727) has the molecular formula C14H17ClO4S and a molecular weight of 316.81 g/mol. Its IUPAC name is methyl 2-[1-[(4-chlorophenyl)methylsulfonylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(4-chlorophenyl)methylsulfonylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776727 |
| Molecular Formula | C14H17ClO4S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | methyl 2-[1-[(4-chlorophenyl)methylsulfonylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)(=O)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H17ClO4S/c1-19-13(16)8-14(6-7-14)10-20(17,18)9-11-2-4-12(15)5-3-11/h2-5H,6-10H2,1H3 |
| InChIKey | OFQOKKVZOJQSOB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |