C15H17NO4S — CID 107776668
methyl 2-[1-[(2-cyanophenyl)methylsulfonylmethyl]cyclopropyl]acetate (PubChem CID 107776668) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is methyl 2-[1-[(2-cyanophenyl)methylsulfonylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(2-cyanophenyl)methylsulfonylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776668 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | methyl 2-[1-[(2-cyanophenyl)methylsulfonylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)(=O)Cc2ccccc2C#N)CC1 |
| InChI | InChI=1S/C15H17NO4S/c1-20-14(17)8-15(6-7-15)11-21(18,19)10-13-5-3-2-4-12(13)9-16/h2-5H,6-8,10-11H2,1H3 |
| InChIKey | GXLWCMIVUPVESP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |