C14H22O4 — CID 63654292
[2-(3,3-diethoxypropoxy)phenyl]methanol (PubChem CID 63654292) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is [2-(3,3-diethoxypropoxy)phenyl]methanol.
| Compound Name | [2-(3,3-diethoxypropoxy)phenyl]methanol |
|---|---|
| PubChem CID | 63654292 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [2-(3,3-diethoxypropoxy)phenyl]methanol |
| SMILES | CCOC(CCOc1ccccc1CO)OCC |
| InChI | InChI=1S/C14H22O4/c1-3-16-14(17-4-2)9-10-18-13-8-6-5-7-12(13)11-15/h5-8,14-15H,3-4,9-11H2,1-2H3 |
| InChIKey | NQPAJFMRLUVLRI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|