About CID 6367156
CID 6367156 (PubChem CID 6367156) has the molecular formula C11H25GeNS-2
and a molecular weight of 276.00 g/mol.
Molecular Properties
| Compound Name | CID 6367156 |
| PubChem CID | 6367156 |
| Molecular Formula | C11H25GeNS-2 |
| Molecular Weight | 276.00 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | — |
| SMILES | CC([S-])C[NH-].CCCC[Ge]CCCC |
| InChI | InChI=1S/C8H18Ge.C3H8NS/c1-3-5-7-9-8-6-4-2;1-3(5)2-4/h3-8H2,1-2H3;3-5H,2H2,1H3/q;-1/p-1 |
| InChIKey | QUXMLZQTUZABJL-UHFFFAOYSA-M |
| XLogP | 4.10 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.00 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 6367156 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6367156?
The IUPAC name of CID 6367156 (CID 6367156) is not available.
What is the SMILES notation for CID 6367156?
The canonical SMILES for CID 6367156 is CC([S-])C[NH-].CCCC[Ge]CCCC.
What is the InChIKey of CID 6367156?
The InChIKey is QUXMLZQTUZABJL-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18Ge.C3H8NS/c1-3-5-7-9-8-6-4-2;1-3(5)2-4/h3-8H2,1-2H3;3-5H,2H2,1H3/q;-1/p-1.
What are the key properties of CID 6367156?
CID 6367156 has a molecular weight of 276.00 g/mol, XLogP of 4.10, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6367156 is sourced from PubChem (CID 6367156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).