About sodium dodecane-2-thiolate
sodium dodecane-2-thiolate (PubChem CID 23677262) has the molecular formula C12H25NaS
and a molecular weight of 224.39 g/mol. Its IUPAC name is sodium dodecane-2-thiolate.
Molecular Properties
| Compound Name | sodium dodecane-2-thiolate |
| PubChem CID | 23677262 |
| Molecular Formula | C12H25NaS |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | sodium dodecane-2-thiolate |
| SMILES | CCCCCCCCCCC(C)[S-].[Na+] |
| InChI | InChI=1S/C12H26S.Na/c1-3-4-5-6-7-8-9-10-11-12(2)13;/h12-13H,3-11H2,1-2H3;/q;+1/p-1 |
| InChIKey | DHQXDCDFVNLVHO-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium dodecane-2-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium dodecane-2-thiolate?
The IUPAC name of sodium dodecane-2-thiolate (CID 23677262) is sodium dodecane-2-thiolate.
What is the SMILES notation for sodium dodecane-2-thiolate?
The canonical SMILES for sodium dodecane-2-thiolate is CCCCCCCCCCC(C)[S-].[Na+].
What is the InChIKey of sodium dodecane-2-thiolate?
The InChIKey is DHQXDCDFVNLVHO-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H26S.Na/c1-3-4-5-6-7-8-9-10-11-12(2)13;/h12-13H,3-11H2,1-2H3;/q;+1/p-1.
What are the key properties of sodium dodecane-2-thiolate?
sodium dodecane-2-thiolate has a molecular weight of 224.39 g/mol, XLogP of 1.46, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium dodecane-2-thiolate is sourced from PubChem (CID 23677262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).