C11H13N3OS2 — CID 63676155
2-propoxy-4-(1,3,4-thiadiazol-2-ylsulfanyl)aniline (PubChem CID 63676155) has the molecular formula C11H13N3OS2 and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-propoxy-4-(1,3,4-thiadiazol-2-ylsulfanyl)aniline.
| Compound Name | 2-propoxy-4-(1,3,4-thiadiazol-2-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 63676155 |
| Molecular Formula | C11H13N3OS2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-propoxy-4-(1,3,4-thiadiazol-2-ylsulfanyl)aniline |
| SMILES | CCCOc1cc(Sc2nncs2)ccc1N |
| InChI | InChI=1S/C11H13N3OS2/c1-2-5-15-10-6-8(3-4-9(10)12)17-11-14-13-7-16-11/h3-4,6-7H,2,5,12H2,1H3 |
| InChIKey | GWRKRGKTXYOXQN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|