C9H21NO2 — CID 63685815
1-(2-propoxyethoxy)butan-2-amine (PubChem CID 63685815) has the molecular formula C9H21NO2 and a molecular weight of 175.27 g/mol. Its IUPAC name is 1-(2-propoxyethoxy)butan-2-amine.
| Compound Name | 1-(2-propoxyethoxy)butan-2-amine |
|---|---|
| PubChem CID | 63685815 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | 1-(2-propoxyethoxy)butan-2-amine |
| SMILES | CCCOCCOCC(N)CC |
| InChI | InChI=1S/C9H21NO2/c1-3-5-11-6-7-12-8-9(10)4-2/h9H,3-8,10H2,1-2H3 |
| InChIKey | CHMVKEKTHHBJON-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|