About 1-propoxypropan-1-amine;1-propoxypropane;hydrate
1-propoxypropan-1-amine;1-propoxypropane;hydrate (PubChem CID 88800294) has the molecular formula C12H31NO3
and a molecular weight of 237.38 g/mol. Its IUPAC name is 1-propoxypropan-1-amine;1-propoxypropane;hydrate.
Molecular Properties
| Compound Name | 1-propoxypropan-1-amine;1-propoxypropane;hydrate |
| PubChem CID | 88800294 |
| Molecular Formula | C12H31NO3 |
| Molecular Weight | 237.38 g/mol |
| Exact Mass | 237.23 |
| IUPAC Name | 1-propoxypropan-1-amine;1-propoxypropane;hydrate |
| SMILES | CCCOC(N)CC.CCCOCCC.O |
| InChI | InChI=1S/C6H15NO.C6H14O.H2O/c1-3-5-8-6(7)4-2;1-3-5-7-6-4-2;/h6H,3-5,7H2,1-2H3;3-6H2,1-2H3;1H2 |
| InChIKey | KGYZDRDACYZGIS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-propoxypropan-1-amine;1-propoxypropane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propoxypropan-1-amine;1-propoxypropane;hydrate?
The IUPAC name of 1-propoxypropan-1-amine;1-propoxypropane;hydrate (CID 88800294) is 1-propoxypropan-1-amine;1-propoxypropane;hydrate.
What is the SMILES notation for 1-propoxypropan-1-amine;1-propoxypropane;hydrate?
The canonical SMILES for 1-propoxypropan-1-amine;1-propoxypropane;hydrate is CCCOC(N)CC.CCCOCCC.O.
What is the InChIKey of 1-propoxypropan-1-amine;1-propoxypropane;hydrate?
The InChIKey is KGYZDRDACYZGIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO.C6H14O.H2O/c1-3-5-8-6(7)4-2;1-3-5-7-6-4-2;/h6H,3-5,7H2,1-2H3;3-6H2,1-2H3;1H2.
What are the key properties of 1-propoxypropan-1-amine;1-propoxypropane;hydrate?
1-propoxypropan-1-amine;1-propoxypropane;hydrate has a molecular weight of 237.38 g/mol, XLogP of 2.11, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propoxypropan-1-amine;1-propoxypropane;hydrate is sourced from PubChem (CID 88800294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).