C17H29BrN2O — CID 63691375
5-bromo-N-(2-ethoxyethyl)-N-ethyl-2-[(2-methylpropylamino)methyl]aniline (PubChem CID 63691375) has the molecular formula C17H29BrN2O and a molecular weight of 357.34 g/mol. Its IUPAC name is 5-bromo-N-(2-ethoxyethyl)-N-ethyl-2-[(2-methylpropylamino)methyl]aniline.
| Compound Name | 5-bromo-N-(2-ethoxyethyl)-N-ethyl-2-[(2-methylpropylamino)methyl]aniline |
|---|---|
| PubChem CID | 63691375 |
| Molecular Formula | C17H29BrN2O |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 5-bromo-N-(2-ethoxyethyl)-N-ethyl-2-[(2-methylpropylamino)methyl]aniline |
| SMILES | CCOCCN(CC)c1cc(Br)ccc1CNCC(C)C |
| InChI | InChI=1S/C17H29BrN2O/c1-5-20(9-10-21-6-2)17-11-16(18)8-7-15(17)13-19-12-14(3)4/h7-8,11,14,19H,5-6,9-10,12-13H2,1-4H3 |
| InChIKey | VBXNKWKIJXZGBS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|