C5H5BF3N2O2- — CID 63702826
(3,6-dioxo-1H-pyridazin-2-yl)methyl-trifluoroboranuide (PubChem CID 63702826) has the molecular formula C5H5BF3N2O2- and a molecular weight of 192.91 g/mol. Its IUPAC name is (3,6-dioxo-1H-pyridazin-2-yl)methyl-trifluoroboranuide.
| Compound Name | (3,6-dioxo-1H-pyridazin-2-yl)methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 63702826 |
| Molecular Formula | C5H5BF3N2O2- |
| Molecular Weight | 192.91 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | (3,6-dioxo-1H-pyridazin-2-yl)methyl-trifluoroboranuide |
| SMILES | O=c1ccc(=O)n(C[B-](F)(F)F)[nH]1 |
| InChI | InChI=1S/C5H5BF3N2O2/c7-6(8,9)3-11-5(13)2-1-4(12)10-11/h1-2H,3H2,(H,10,12)/q-1 |
| InChIKey | SCOLKYDYEMPYGR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.91 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|