C12H8F2N2O3 — CID 62019372
2-[2-(2,5-difluorophenyl)-2-oxoethyl]-1H-pyridazine-3,6-dione (PubChem CID 62019372) has the molecular formula C12H8F2N2O3 and a molecular weight of 266.20 g/mol. Its IUPAC name is 2-[2-(2,5-difluorophenyl)-2-oxoethyl]-1H-pyridazine-3,6-dione.
| Compound Name | 2-[2-(2,5-difluorophenyl)-2-oxoethyl]-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 62019372 |
| Molecular Formula | C12H8F2N2O3 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-[2-(2,5-difluorophenyl)-2-oxoethyl]-1H-pyridazine-3,6-dione |
| SMILES | O=C(Cn1[nH]c(=O)ccc1=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H8F2N2O3/c13-7-1-2-9(14)8(5-7)10(17)6-16-12(19)4-3-11(18)15-16/h1-5H,6H2,(H,15,18) |
| InChIKey | OXLRPRCRKLXBCQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |