C6H13BF3KN2O — CID 63703594
potassium [(2-amino-2-oxoethyl)-propan-2-ylamino]methyl-trifluoroboranuide (PubChem CID 63703594) has the molecular formula C6H13BF3KN2O and a molecular weight of 236.09 g/mol. Its IUPAC name is potassium [(2-amino-2-oxoethyl)-propan-2-ylamino]methyl-trifluoroboranuide.
| Compound Name | potassium [(2-amino-2-oxoethyl)-propan-2-ylamino]methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 63703594 |
| Molecular Formula | C6H13BF3KN2O |
| Molecular Weight | 236.09 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | potassium [(2-amino-2-oxoethyl)-propan-2-ylamino]methyl-trifluoroboranuide |
| SMILES | CC(C)N(CC(N)=O)C[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C6H13BF3N2O.K/c1-5(2)12(3-6(11)13)4-7(8,9)10;/h5H,3-4H2,1-2H3,(H2,11,13);/q-1;+1 |
| InChIKey | GAMFBDUCQSFRGC-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.09 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|