C8H16BF3KN — CID 63703846
potassium (2,4-dimethylpiperidin-1-yl)methyl-trifluoroboranuide (PubChem CID 63703846) has the molecular formula C8H16BF3KN and a molecular weight of 233.13 g/mol. Its IUPAC name is potassium (2,4-dimethylpiperidin-1-yl)methyl-trifluoroboranuide.
| Compound Name | potassium (2,4-dimethylpiperidin-1-yl)methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 63703846 |
| Molecular Formula | C8H16BF3KN |
| Molecular Weight | 233.13 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | potassium (2,4-dimethylpiperidin-1-yl)methyl-trifluoroboranuide |
| SMILES | CC1CCN(C[B-](F)(F)F)C(C)C1.[K+] |
| InChI | InChI=1S/C8H16BF3N.K/c1-7-3-4-13(8(2)5-7)6-9(10,11)12;/h7-8H,3-6H2,1-2H3;/q-1;+1 |
| InChIKey | MMSPXRHHNZDXNZ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.13 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|