C13H13ClN2O2 — CID 63709734
2-(2-chloroethyl)-5-(3,4-dihydro-2H-chromen-4-yl)-1,3,4-oxadiazole (PubChem CID 63709734) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(3,4-dihydro-2H-chromen-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloroethyl)-5-(3,4-dihydro-2H-chromen-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 63709734 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-(2-chloroethyl)-5-(3,4-dihydro-2H-chromen-4-yl)-1,3,4-oxadiazole |
| SMILES | ClCCc1nnc(C2CCOc3ccccc32)o1 |
| InChI | InChI=1S/C13H13ClN2O2/c14-7-5-12-15-16-13(18-12)10-6-8-17-11-4-2-1-3-9(10)11/h1-4,10H,5-8H2 |
| InChIKey | ACWKRLOTJOAPQZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|