C16H20N2O2S — CID 63709938
N-(2-carbamothioylcyclopentyl)-3,4-dihydro-2H-chromene-4-carboxamide (PubChem CID 63709938) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is N-(2-carbamothioylcyclopentyl)-3,4-dihydro-2H-chromene-4-carboxamide.
| Compound Name | N-(2-carbamothioylcyclopentyl)-3,4-dihydro-2H-chromene-4-carboxamide |
|---|---|
| PubChem CID | 63709938 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(2-carbamothioylcyclopentyl)-3,4-dihydro-2H-chromene-4-carboxamide |
| SMILES | NC(=S)C1CCCC1NC(=O)C1CCOc2ccccc21 |
| InChI | InChI=1S/C16H20N2O2S/c17-15(21)12-5-3-6-13(12)18-16(19)11-8-9-20-14-7-2-1-4-10(11)14/h1-2,4,7,11-13H,3,5-6,8-9H2,(H2,17,21)(H,18,19) |
| InChIKey | VCKHAJXSGVRBSP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|